C88H78 — CID 132596356
2,3,4-tris(4-tert-butylphenyl)-1,5-bis[4-(1,2,2-triphenylethenyl)phenyl]benzene (PubChem CID 132596356) has the molecular formula C88H78 and a molecular weight of 1135.59 g/mol. Its IUPAC name is 2,3,4-tris(4-tert-butylphenyl)-1,5-bis[4-(1,2,2-triphenylethenyl)phenyl]benzene.
| Compound Name | 2,3,4-tris(4-tert-butylphenyl)-1,5-bis[4-(1,2,2-triphenylethenyl)phenyl]benzene |
|---|---|
| PubChem CID | 132596356 |
| Molecular Formula | C88H78 |
| Molecular Weight | 1135.59 g/mol |
| Exact Mass | 1134.61 |
| IUPAC Name | 2,3,4-tris(4-tert-butylphenyl)-1,5-bis[4-(1,2,2-triphenylethenyl)phenyl]benzene |
| SMILES | CC(C)(C)c1ccc(-c2c(-c3ccc(C(=C(c4ccccc4)c4ccccc4)c4ccccc4)cc3)cc(-c3ccc(C(=C(c4ccccc4)c4ccccc4)c4ccccc4)cc3)c(-c3ccc(C(C)(C)C)cc3)c2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C88H78/c1-86(2,3)74-54-48-71(49-55-74)83-77(61-40-44-69(45-41-61)81(67-36-24-14-25-37-67)79(63-28-16-10-17-29-63)64-30-18-11-19-31-64)60-78(84(72-50-56-75(57-51-72)87(4,5)6)85(83)73-52-58-76(59-53-73)88(7,8)9)62-42-46-70(47-43-62)82(68-38-26-15-27-39-68)80(65-32-20-12-21-33-65)66-34-22-13-23-35-66/h10-60H,1-9H3 |
| InChIKey | GXNHQIHFYIWCSL-UHFFFAOYSA-N |
| XLogP | 23.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1135.59 |
| LogP ≤ 5 | 23.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|