About 3-bromopyrido[1,2-a]benzimidazole
3-bromopyrido[1,2-a]benzimidazole (PubChem CID 132596716) has the molecular formula C11H7BrN2
and a molecular weight of 247.10 g/mol. Its IUPAC name is 3-bromopyrido[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | 3-bromopyrido[1,2-a]benzimidazole |
| PubChem CID | 132596716 |
| Molecular Formula | C11H7BrN2 |
| Molecular Weight | 247.10 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | 3-bromopyrido[1,2-a]benzimidazole |
| SMILES | Brc1ccn2c(c1)nc1ccccc12 |
| InChI | InChI=1S/C11H7BrN2/c12-8-5-6-14-10-4-2-1-3-9(10)13-11(14)7-8/h1-7H |
| InChIKey | YWBSQLFNAWUXHX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.10 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromopyrido[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromopyrido[1,2-a]benzimidazole?
The IUPAC name of 3-bromopyrido[1,2-a]benzimidazole (CID 132596716) is 3-bromopyrido[1,2-a]benzimidazole.
What is the SMILES notation for 3-bromopyrido[1,2-a]benzimidazole?
The canonical SMILES for 3-bromopyrido[1,2-a]benzimidazole is Brc1ccn2c(c1)nc1ccccc12.
What is the InChIKey of 3-bromopyrido[1,2-a]benzimidazole?
The InChIKey is YWBSQLFNAWUXHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BrN2/c12-8-5-6-14-10-4-2-1-3-9(10)13-11(14)7-8/h1-7H.
What are the key properties of 3-bromopyrido[1,2-a]benzimidazole?
3-bromopyrido[1,2-a]benzimidazole has a molecular weight of 247.10 g/mol, XLogP of 3.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromopyrido[1,2-a]benzimidazole is sourced from PubChem (CID 132596716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).