C35H21Cl4N5O2 — CID 132596839
(3aS,4R,6R,7R,7aS)-4,6-bis(3,4-dichlorophenyl)-7a-hydroxy-3-imino-1-oxo-2,7-diphenyl-6,7-dihydro-4H-isoindole-3a,5,5-tricarbonitrile (PubChem CID 132596839) has the molecular formula C35H21Cl4N5O2 and a molecular weight of 685.40 g/mol. Its IUPAC name is (3aS,4R,6R,7R,7aS)-4,6-bis(3,4-dichlorophenyl)-7a-hydroxy-3-imino-1-oxo-2,7-diphenyl-6,7-dihydro-4H-isoindole-3a,5,5-tricarbonitrile.
| Compound Name | (3aS,4R,6R,7R,7aS)-4,6-bis(3,4-dichlorophenyl)-7a-hydroxy-3-imino-1-oxo-2,7-diphenyl-6,7-dihydro-4H-isoindole-3a,5,5-tricarbonitrile |
|---|---|
| PubChem CID | 132596839 |
| Molecular Formula | C35H21Cl4N5O2 |
| Molecular Weight | 685.40 g/mol |
| Exact Mass | 683.04 |
| IUPAC Name | (3aS,4R,6R,7R,7aS)-4,6-bis(3,4-dichlorophenyl)-7a-hydroxy-3-imino-1-oxo-2,7-diphenyl-6,7-dihydro-4H-isoindole-3a,5,5-tricarbonitrile |
| SMILES | [H]/N=C1\N(c2ccccc2)C(=O)[C@]2(O)[C@@H](c3ccccc3)[C@H](c3ccc(Cl)c(Cl)c3)C(C#N)(C#N)[C@@H](c3ccc(Cl)c(Cl)c3)[C@]12C#N |
| InChI | InChI=1S/C35H21Cl4N5O2/c36-24-13-11-21(15-26(24)38)28-29(20-7-3-1-4-8-20)35(46)32(45)44(23-9-5-2-6-10-23)31(43)34(35,19-42)30(33(28,17-40)18-41)22-12-14-25(37)27(39)16-22/h1-16,28-30,43,46H/b43-31-/t28-,29-,30+,34+,35+/m0/s1 |
| InChIKey | ZQRBTDIFFACWLV-XCORDHLDSA-N |
| XLogP | 8.26 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.40 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|