About 7,8-dichloro-3-methyl-[1,3]thiazino[3,2-a]benzimidazol-4-one
7,8-dichloro-3-methyl-[1,3]thiazino[3,2-a]benzimidazol-4-one (PubChem CID 132596865) has the molecular formula C11H6Cl2N2OS
and a molecular weight of 285.16 g/mol. Its IUPAC name is 7,8-dichloro-3-methyl-[1,3]thiazino[3,2-a]benzimidazol-4-one.
Molecular Properties
| Compound Name | 7,8-dichloro-3-methyl-[1,3]thiazino[3,2-a]benzimidazol-4-one |
| PubChem CID | 132596865 |
| Molecular Formula | C11H6Cl2N2OS |
| Molecular Weight | 285.16 g/mol |
| Exact Mass | 283.96 |
| IUPAC Name | 7,8-dichloro-3-methyl-[1,3]thiazino[3,2-a]benzimidazol-4-one |
| SMILES | Cc1csc2nc3cc(Cl)c(Cl)cc3n2c1=O |
| InChI | InChI=1S/C11H6Cl2N2OS/c1-5-4-17-11-14-8-2-6(12)7(13)3-9(8)15(11)10(5)16/h2-4H,1H3 |
| InChIKey | XAMUQYXPUSWVOQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.16 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7,8-dichloro-3-methyl-[1,3]thiazino[3,2-a]benzimidazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dichloro-3-methyl-[1,3]thiazino[3,2-a]benzimidazol-4-one?
The IUPAC name of 7,8-dichloro-3-methyl-[1,3]thiazino[3,2-a]benzimidazol-4-one (CID 132596865) is 7,8-dichloro-3-methyl-[1,3]thiazino[3,2-a]benzimidazol-4-one.
What is the SMILES notation for 7,8-dichloro-3-methyl-[1,3]thiazino[3,2-a]benzimidazol-4-one?
The canonical SMILES for 7,8-dichloro-3-methyl-[1,3]thiazino[3,2-a]benzimidazol-4-one is Cc1csc2nc3cc(Cl)c(Cl)cc3n2c1=O.
What is the InChIKey of 7,8-dichloro-3-methyl-[1,3]thiazino[3,2-a]benzimidazol-4-one?
The InChIKey is XAMUQYXPUSWVOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6Cl2N2OS/c1-5-4-17-11-14-8-2-6(12)7(13)3-9(8)15(11)10(5)16/h2-4H,1H3.
What are the key properties of 7,8-dichloro-3-methyl-[1,3]thiazino[3,2-a]benzimidazol-4-one?
7,8-dichloro-3-methyl-[1,3]thiazino[3,2-a]benzimidazol-4-one has a molecular weight of 285.16 g/mol, XLogP of 3.52, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dichloro-3-methyl-[1,3]thiazino[3,2-a]benzimidazol-4-one is sourced from PubChem (CID 132596865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).