C8H12O4 — CID 132597080
(3aR,6S,6aR)-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one (PubChem CID 132597080) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is (3aR,6S,6aR)-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one.
| Compound Name | (3aR,6S,6aR)-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 132597080 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (3aR,6S,6aR)-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
| SMILES | C[C@@H]1OC(=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C8H12O4/c1-4-5-6(7(9)10-4)12-8(2,3)11-5/h4-6H,1-3H3/t4-,5+,6+/m0/s1 |
| InChIKey | YUGRZMZGERGITJ-KVQBGUIXSA-N |
| XLogP | 0.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |