C32H20F17N3O — CID 132597360
4-[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]-2,6-dipyridin-2-ylpyridine (PubChem CID 132597360) has the molecular formula C32H20F17N3O and a molecular weight of 785.50 g/mol. Its IUPAC name is 4-[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 132597360 |
| Molecular Formula | C32H20F17N3O |
| Molecular Weight | 785.50 g/mol |
| Exact Mass | 785.13 |
| IUPAC Name | 4-[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]-2,6-dipyridin-2-ylpyridine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCOc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C32H20F17N3O/c33-25(34,26(35,36)27(37,38)28(39,40)29(41,42)30(43,44)31(45,46)32(47,48)49)12-5-15-53-20-10-8-18(9-11-20)19-16-23(21-6-1-3-13-50-21)52-24(17-19)22-7-2-4-14-51-22/h1-4,6-11,13-14,16-17H,5,12,15H2 |
| InChIKey | PAUCHAAKOWVPOC-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.50 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|