C12H16N2 — CID 132597725
2,4-bis(ethenyl)-5,6-diethylpyrimidine (PubChem CID 132597725) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2,4-bis(ethenyl)-5,6-diethylpyrimidine.
| Compound Name | 2,4-bis(ethenyl)-5,6-diethylpyrimidine |
|---|---|
| PubChem CID | 132597725 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2,4-bis(ethenyl)-5,6-diethylpyrimidine |
| SMILES | C=Cc1nc(C=C)c(CC)c(CC)n1 |
| InChI | InChI=1S/C12H16N2/c1-5-9-10(6-2)13-12(8-4)14-11(9)7-3/h6,8H,2,4-5,7H2,1,3H3 |
| InChIKey | JWQWQUPRHOHEBL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |