C21H16F8 — CID 132598016
1,2,4,5-tetrafluoro-3-[(6E)-8-(4-fluorophenyl)octa-1,6-dien-3-yl]-6-(trifluoromethyl)benzene (PubChem CID 132598016) has the molecular formula C21H16F8 and a molecular weight of 420.34 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-[(6E)-8-(4-fluorophenyl)octa-1,6-dien-3-yl]-6-(trifluoromethyl)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-[(6E)-8-(4-fluorophenyl)octa-1,6-dien-3-yl]-6-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 132598016 |
| Molecular Formula | C21H16F8 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-[(6E)-8-(4-fluorophenyl)octa-1,6-dien-3-yl]-6-(trifluoromethyl)benzene |
| SMILES | C=CC(CC/C=C/Cc1ccc(F)cc1)c1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C21H16F8/c1-2-13(7-5-3-4-6-12-8-10-14(22)11-9-12)15-17(23)19(25)16(21(27,28)29)20(26)18(15)24/h2-4,8-11,13H,1,5-7H2/b4-3+ |
| InChIKey | SDYHEXCZDJTIJK-ONEGZZNKSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|