About 3,3-bis(4-fluorophenyl)-5,5-dimethyl-2-naphthalen-2-ylmorpholin-2-amine
3,3-bis(4-fluorophenyl)-5,5-dimethyl-2-naphthalen-2-ylmorpholin-2-amine (PubChem CID 132598684) has the molecular formula C28H26F2N2O
and a molecular weight of 444.53 g/mol. Its IUPAC name is 3,3-bis(4-fluorophenyl)-5,5-dimethyl-2-naphthalen-2-ylmorpholin-2-amine.
Molecular Properties
| Compound Name | 3,3-bis(4-fluorophenyl)-5,5-dimethyl-2-naphthalen-2-ylmorpholin-2-amine |
| PubChem CID | 132598684 |
| Molecular Formula | C28H26F2N2O |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 3,3-bis(4-fluorophenyl)-5,5-dimethyl-2-naphthalen-2-ylmorpholin-2-amine |
| SMILES | CC1(C)COC(N)(c2ccc3ccccc3c2)C(c2ccc(F)cc2)(c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C28H26F2N2O/c1-26(2)18-33-28(31,23-8-7-19-5-3-4-6-20(19)17-23)27(32-26,21-9-13-24(29)14-10-21)22-11-15-25(30)16-12-22/h3-17,32H,18,31H2,1-2H3 |
| InChIKey | KDZWWWKXGLVNLL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-bis(4-fluorophenyl)-5,5-dimethyl-2-naphthalen-2-ylmorpholin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(4-fluorophenyl)-5,5-dimethyl-2-naphthalen-2-ylmorpholin-2-amine?
The IUPAC name of 3,3-bis(4-fluorophenyl)-5,5-dimethyl-2-naphthalen-2-ylmorpholin-2-amine (CID 132598684) is 3,3-bis(4-fluorophenyl)-5,5-dimethyl-2-naphthalen-2-ylmorpholin-2-amine.
What is the SMILES notation for 3,3-bis(4-fluorophenyl)-5,5-dimethyl-2-naphthalen-2-ylmorpholin-2-amine?
The canonical SMILES for 3,3-bis(4-fluorophenyl)-5,5-dimethyl-2-naphthalen-2-ylmorpholin-2-amine is CC1(C)COC(N)(c2ccc3ccccc3c2)C(c2ccc(F)cc2)(c2ccc(F)cc2)N1.
What is the InChIKey of 3,3-bis(4-fluorophenyl)-5,5-dimethyl-2-naphthalen-2-ylmorpholin-2-amine?
The InChIKey is KDZWWWKXGLVNLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26F2N2O/c1-26(2)18-33-28(31,23-8-7-19-5-3-4-6-20(19)17-23)27(32-26,21-9-13-24(29)14-10-21)22-11-15-25(30)16-12-22/h3-17,32H,18,31H2,1-2H3.
What are the key properties of 3,3-bis(4-fluorophenyl)-5,5-dimethyl-2-naphthalen-2-ylmorpholin-2-amine?
3,3-bis(4-fluorophenyl)-5,5-dimethyl-2-naphthalen-2-ylmorpholin-2-amine has a molecular weight of 444.53 g/mol, XLogP of 5.57, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(4-fluorophenyl)-5,5-dimethyl-2-naphthalen-2-ylmorpholin-2-amine is sourced from PubChem (CID 132598684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).