C22H23NO3 — CID 132599616
(3aS,4R,9aS)-2-tert-butyl-4-hydroxy-4-phenyl-9,9a-dihydro-3aH-benzo[f]isoindole-1,3-dione (PubChem CID 132599616) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is (3aS,4R,9aS)-2-tert-butyl-4-hydroxy-4-phenyl-9,9a-dihydro-3aH-benzo[f]isoindole-1,3-dione.
| Compound Name | (3aS,4R,9aS)-2-tert-butyl-4-hydroxy-4-phenyl-9,9a-dihydro-3aH-benzo[f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 132599616 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (3aS,4R,9aS)-2-tert-butyl-4-hydroxy-4-phenyl-9,9a-dihydro-3aH-benzo[f]isoindole-1,3-dione |
| SMILES | CC(C)(C)N1C(=O)[C@H]2Cc3ccccc3[C@](O)(c3ccccc3)[C@H]2C1=O |
| InChI | InChI=1S/C22H23NO3/c1-21(2,3)23-19(24)16-13-14-9-7-8-12-17(14)22(26,18(16)20(23)25)15-10-5-4-6-11-15/h4-12,16,18,26H,13H2,1-3H3/t16-,18+,22+/m0/s1 |
| InChIKey | NGWVEGUNIXKUGH-AQOAWAETSA-N |
| XLogP | 2.88 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|