C30H39NO3 — CID 132599623
(3aS,4R,9aS)-2-tert-butyl-4-(3,5-ditert-butylphenyl)-4-hydroxy-9,9a-dihydro-3aH-benzo[f]isoindole-1,3-dione (PubChem CID 132599623) has the molecular formula C30H39NO3 and a molecular weight of 461.65 g/mol. Its IUPAC name is (3aS,4R,9aS)-2-tert-butyl-4-(3,5-ditert-butylphenyl)-4-hydroxy-9,9a-dihydro-3aH-benzo[f]isoindole-1,3-dione.
| Compound Name | (3aS,4R,9aS)-2-tert-butyl-4-(3,5-ditert-butylphenyl)-4-hydroxy-9,9a-dihydro-3aH-benzo[f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 132599623 |
| Molecular Formula | C30H39NO3 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | (3aS,4R,9aS)-2-tert-butyl-4-(3,5-ditert-butylphenyl)-4-hydroxy-9,9a-dihydro-3aH-benzo[f]isoindole-1,3-dione |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)cc([C@@]2(O)c3ccccc3C[C@@H]3C(=O)N(C(C)(C)C)C(=O)[C@@H]32)c1 |
| InChI | InChI=1S/C30H39NO3/c1-27(2,3)19-15-20(28(4,5)6)17-21(16-19)30(34)23-13-11-10-12-18(23)14-22-24(30)26(33)31(25(22)32)29(7,8)9/h10-13,15-17,22,24,34H,14H2,1-9H3/t22-,24+,30+/m0/s1 |
| InChIKey | YYMQHYLEFUXGBS-UKOGBCMFSA-N |
| XLogP | 5.47 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|