About 6-tert-butyl-N,1-di(propan-2-yl)benzimidazol-2-amine
6-tert-butyl-N,1-di(propan-2-yl)benzimidazol-2-amine (PubChem CID 132599814) has the molecular formula C17H27N3
and a molecular weight of 273.42 g/mol. Its IUPAC name is 6-tert-butyl-N,1-di(propan-2-yl)benzimidazol-2-amine.
Molecular Properties
| Compound Name | 6-tert-butyl-N,1-di(propan-2-yl)benzimidazol-2-amine |
| PubChem CID | 132599814 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | 6-tert-butyl-N,1-di(propan-2-yl)benzimidazol-2-amine |
| SMILES | CC(C)Nc1nc2ccc(C(C)(C)C)cc2n1C(C)C |
| InChI | InChI=1S/C17H27N3/c1-11(2)18-16-19-14-9-8-13(17(5,6)7)10-15(14)20(16)12(3)4/h8-12H,1-7H3,(H,18,19) |
| InChIKey | OOFMJTUBXIYLHF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-tert-butyl-N,1-di(propan-2-yl)benzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-N,1-di(propan-2-yl)benzimidazol-2-amine?
The IUPAC name of 6-tert-butyl-N,1-di(propan-2-yl)benzimidazol-2-amine (CID 132599814) is 6-tert-butyl-N,1-di(propan-2-yl)benzimidazol-2-amine.
What is the SMILES notation for 6-tert-butyl-N,1-di(propan-2-yl)benzimidazol-2-amine?
The canonical SMILES for 6-tert-butyl-N,1-di(propan-2-yl)benzimidazol-2-amine is CC(C)Nc1nc2ccc(C(C)(C)C)cc2n1C(C)C.
What is the InChIKey of 6-tert-butyl-N,1-di(propan-2-yl)benzimidazol-2-amine?
The InChIKey is OOFMJTUBXIYLHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N3/c1-11(2)18-16-19-14-9-8-13(17(5,6)7)10-15(14)20(16)12(3)4/h8-12H,1-7H3,(H,18,19).
What are the key properties of 6-tert-butyl-N,1-di(propan-2-yl)benzimidazol-2-amine?
6-tert-butyl-N,1-di(propan-2-yl)benzimidazol-2-amine has a molecular weight of 273.42 g/mol, XLogP of 4.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-N,1-di(propan-2-yl)benzimidazol-2-amine is sourced from PubChem (CID 132599814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).