C37H39N3O4 — CID 132600130
tert-butyl 2-[[(1S)-2-oxo-1-phenyl-2-(tritylamino)ethyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 132600130) has the molecular formula C37H39N3O4 and a molecular weight of 589.74 g/mol. Its IUPAC name is tert-butyl 2-[[(1S)-2-oxo-1-phenyl-2-(tritylamino)ethyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(1S)-2-oxo-1-phenyl-2-(tritylamino)ethyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 132600130 |
| Molecular Formula | C37H39N3O4 |
| Molecular Weight | 589.74 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | tert-butyl 2-[[(1S)-2-oxo-1-phenyl-2-(tritylamino)ethyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)N[C@H](C(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H39N3O4/c1-36(2,3)44-35(43)40-26-16-25-31(40)33(41)38-32(27-17-8-4-9-18-27)34(42)39-37(28-19-10-5-11-20-28,29-21-12-6-13-22-29)30-23-14-7-15-24-30/h4-15,17-24,31-32H,16,25-26H2,1-3H3,(H,38,41)(H,39,42)/t31?,32-/m0/s1 |
| InChIKey | MSDYTABUFPKFDK-JYUUXGOASA-N |
| XLogP | 6.35 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.74 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|