C12H20O3 — CID 132600131
1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylbut-3-en-1-ol (PubChem CID 132600131) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylbut-3-en-1-ol.
| Compound Name | 1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylbut-3-en-1-ol |
|---|---|
| PubChem CID | 132600131 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylbut-3-en-1-ol |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@@H]1C(O)CC(=C)C |
| InChI | InChI=1S/C12H20O3/c1-6-10-11(9(13)7-8(2)3)15-12(4,5)14-10/h6,9-11,13H,1-2,7H2,3-5H3/t9?,10-,11+/m0/s1 |
| InChIKey | QEIJYSNMLZMROP-QXXIUIOUSA-N |
| XLogP | 2.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|