C19H24O3S — CID 132600193
2-(cyclohexen-1-yl)-5,5-dimethyl-3-(4-methylphenyl)sulfonyl-2H-furan (PubChem CID 132600193) has the molecular formula C19H24O3S and a molecular weight of 332.46 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-5,5-dimethyl-3-(4-methylphenyl)sulfonyl-2H-furan.
| Compound Name | 2-(cyclohexen-1-yl)-5,5-dimethyl-3-(4-methylphenyl)sulfonyl-2H-furan |
|---|---|
| PubChem CID | 132600193 |
| Molecular Formula | C19H24O3S |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-(cyclohexen-1-yl)-5,5-dimethyl-3-(4-methylphenyl)sulfonyl-2H-furan |
| SMILES | Cc1ccc(S(=O)(=O)C2=CC(C)(C)OC2C2=CCCCC2)cc1 |
| InChI | InChI=1S/C19H24O3S/c1-14-9-11-16(12-10-14)23(20,21)17-13-19(2,3)22-18(17)15-7-5-4-6-8-15/h7,9-13,18H,4-6,8H2,1-3H3 |
| InChIKey | OUZFGGPLZUROAA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|