C24H32O7Si — CID 132600338
2-[(2S,3R,4Z)-4-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methylidene]-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-oxooxolan-3-yl]-2-oxoacetaldehyde (PubChem CID 132600338) has the molecular formula C24H32O7Si and a molecular weight of 460.60 g/mol. Its IUPAC name is 2-[(2S,3R,4Z)-4-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methylidene]-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-oxooxolan-3-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[(2S,3R,4Z)-4-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methylidene]-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-oxooxolan-3-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 132600338 |
| Molecular Formula | C24H32O7Si |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 2-[(2S,3R,4Z)-4-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methylidene]-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-oxooxolan-3-yl]-2-oxoacetaldehyde |
| SMILES | CC1(C)OC[C@H]([C@H]2OC(=O)/C(=C\c3ccc(O[Si](C)(C)C(C)(C)C)cc3)[C@H]2C(=O)C=O)O1 |
| InChI | InChI=1S/C24H32O7Si/c1-23(2,3)32(6,7)31-16-10-8-15(9-11-16)12-17-20(18(26)13-25)21(29-22(17)27)19-14-28-24(4,5)30-19/h8-13,19-21H,14H2,1-7H3/b17-12-/t19-,20+,21-/m1/s1 |
| InChIKey | SOPQWURPJFOUAK-SIMMVHBGSA-N |
| XLogP | 3.92 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|