C37H22BF9 — CID 132600826
2,3,4,5-tetraphenyl-1-[2,4,6-tris(trifluoromethyl)phenyl]borole (PubChem CID 132600826) has the molecular formula C37H22BF9 and a molecular weight of 648.38 g/mol. Its IUPAC name is 2,3,4,5-tetraphenyl-1-[2,4,6-tris(trifluoromethyl)phenyl]borole.
| Compound Name | 2,3,4,5-tetraphenyl-1-[2,4,6-tris(trifluoromethyl)phenyl]borole |
|---|---|
| PubChem CID | 132600826 |
| Molecular Formula | C37H22BF9 |
| Molecular Weight | 648.38 g/mol |
| Exact Mass | 648.17 |
| IUPAC Name | 2,3,4,5-tetraphenyl-1-[2,4,6-tris(trifluoromethyl)phenyl]borole |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)c(B2C(c3ccccc3)=C(c3ccccc3)C(c3ccccc3)=C2c2ccccc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C37H22BF9/c39-35(40,41)27-21-28(36(42,43)44)34(29(22-27)37(45,46)47)38-32(25-17-9-3-10-18-25)30(23-13-5-1-6-14-23)31(24-15-7-2-8-16-24)33(38)26-19-11-4-12-20-26/h1-22H |
| InChIKey | VAFRZZLIHJMKDR-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.38 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|