C8H4ClN3S — CID 132600937
12-chloro-7-thia-2,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene (PubChem CID 132600937) has the molecular formula C8H4ClN3S and a molecular weight of 209.66 g/mol. Its IUPAC name is 12-chloro-7-thia-2,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene.
| Compound Name | 12-chloro-7-thia-2,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene |
|---|---|
| PubChem CID | 132600937 |
| Molecular Formula | C8H4ClN3S |
| Molecular Weight | 209.66 g/mol |
| Exact Mass | 208.98 |
| IUPAC Name | 12-chloro-7-thia-2,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene |
| SMILES | Clc1ncnc2sc3cccn3c12 |
| InChI | InChI=1S/C8H4ClN3S/c9-7-6-8(11-4-10-7)13-5-2-1-3-12(5)6/h1-4H |
| InChIKey | YGIXVSWWMHQQRT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.66 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |