C20H21NO — CID 132601084
5-methoxy-2,3-dimethyl-3-[(E)-3-phenylprop-2-enyl]indole (PubChem CID 132601084) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is 5-methoxy-2,3-dimethyl-3-[(E)-3-phenylprop-2-enyl]indole.
| Compound Name | 5-methoxy-2,3-dimethyl-3-[(E)-3-phenylprop-2-enyl]indole |
|---|---|
| PubChem CID | 132601084 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 5-methoxy-2,3-dimethyl-3-[(E)-3-phenylprop-2-enyl]indole |
| SMILES | COc1ccc2c(c1)C(C)(C/C=C/c1ccccc1)C(C)=N2 |
| InChI | InChI=1S/C20H21NO/c1-15-20(2,13-7-10-16-8-5-4-6-9-16)18-14-17(22-3)11-12-19(18)21-15/h4-12,14H,13H2,1-3H3/b10-7+ |
| InChIKey | HIYGJGJRCOEOSK-JXMROGBWSA-N |
| XLogP | 5.16 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |