C23H13NO4S — CID 132601773
7-(1,3-benzodioxol-5-yl)chromeno[3,4-c][1,5]benzothiazepin-6-one (PubChem CID 132601773) has the molecular formula C23H13NO4S and a molecular weight of 399.43 g/mol. Its IUPAC name is 7-(1,3-benzodioxol-5-yl)chromeno[3,4-c][1,5]benzothiazepin-6-one.
| Compound Name | 7-(1,3-benzodioxol-5-yl)chromeno[3,4-c][1,5]benzothiazepin-6-one |
|---|---|
| PubChem CID | 132601773 |
| Molecular Formula | C23H13NO4S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 7-(1,3-benzodioxol-5-yl)chromeno[3,4-c][1,5]benzothiazepin-6-one |
| SMILES | O=c1oc2ccccc2c2c1=C(c1ccc3c(c1)OCO3)Sc1ccccc1N=2 |
| InChI | InChI=1S/C23H13NO4S/c25-23-20-21(14-5-1-3-7-16(14)28-23)24-15-6-2-4-8-19(15)29-22(20)13-9-10-17-18(11-13)27-12-26-17/h1-11H,12H2 |
| InChIKey | XMVDNZOLBHOAMS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 61.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|