C29H33N3O2 — CID 132602307
3,11-dibutyl-13-[(4-methylphenyl)methyl]-3,11,13-triazatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),5,7,9(16),10(14)-pentaene-2,4-dione (PubChem CID 132602307) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is 3,11-dibutyl-13-[(4-methylphenyl)methyl]-3,11,13-triazatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),5,7,9(16),10(14)-pentaene-2,4-dione.
| Compound Name | 3,11-dibutyl-13-[(4-methylphenyl)methyl]-3,11,13-triazatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),5,7,9(16),10(14)-pentaene-2,4-dione |
|---|---|
| PubChem CID | 132602307 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | 3,11-dibutyl-13-[(4-methylphenyl)methyl]-3,11,13-triazatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),5,7,9(16),10(14)-pentaene-2,4-dione |
| SMILES | CCCCN1C(=O)c2cccc3c4c(cc(c23)C1=O)N(Cc1ccc(C)cc1)CN4CCCC |
| InChI | InChI=1S/C29H33N3O2/c1-4-6-15-30-19-31(18-21-13-11-20(3)12-14-21)25-17-24-26-22(27(25)30)9-8-10-23(26)28(33)32(29(24)34)16-7-5-2/h8-14,17H,4-7,15-16,18-19H2,1-3H3 |
| InChIKey | OKQKKPHYIOORGQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|