C11H8F6N6 — CID 132602373
N,N'-bis(2,5,6-trifluoropyrimidin-4-yl)propane-1,3-diamine (PubChem CID 132602373) has the molecular formula C11H8F6N6 and a molecular weight of 338.22 g/mol. Its IUPAC name is N,N'-bis(2,5,6-trifluoropyrimidin-4-yl)propane-1,3-diamine.
| Compound Name | N,N'-bis(2,5,6-trifluoropyrimidin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 132602373 |
| Molecular Formula | C11H8F6N6 |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | N,N'-bis(2,5,6-trifluoropyrimidin-4-yl)propane-1,3-diamine |
| SMILES | Fc1nc(F)c(F)c(NCCCNc2nc(F)nc(F)c2F)n1 |
| InChI | InChI=1S/C11H8F6N6/c12-4-6(14)20-10(16)22-8(4)18-2-1-3-19-9-5(13)7(15)21-11(17)23-9/h1-3H2,(H,18,20,22)(H,19,21,23) |
| InChIKey | KBIJUVJHAYFXSS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|