C12H13N3O — CID 132602735
12,12-dimethyl-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene (PubChem CID 132602735) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 12,12-dimethyl-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene.
| Compound Name | 12,12-dimethyl-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene |
|---|---|
| PubChem CID | 132602735 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 12,12-dimethyl-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene |
| SMILES | CC1(C)COc2cccc3ncnc(c23)N1 |
| InChI | InChI=1S/C12H13N3O/c1-12(2)6-16-9-5-3-4-8-10(9)11(15-12)14-7-13-8/h3-5,7H,6H2,1-2H3,(H,13,14,15) |
| InChIKey | HKXSHPOVLTZVSE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |