C14H14N2O2 — CID 132602875
1-(2-nitrophenyl)-5,6,7,8-tetrahydroindolizine (PubChem CID 132602875) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 1-(2-nitrophenyl)-5,6,7,8-tetrahydroindolizine.
| Compound Name | 1-(2-nitrophenyl)-5,6,7,8-tetrahydroindolizine |
|---|---|
| PubChem CID | 132602875 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1-(2-nitrophenyl)-5,6,7,8-tetrahydroindolizine |
| SMILES | O=[N+]([O-])c1ccccc1-c1ccn2c1CCCC2 |
| InChI | InChI=1S/C14H14N2O2/c17-16(18)14-7-2-1-5-11(14)12-8-10-15-9-4-3-6-13(12)15/h1-2,5,7-8,10H,3-4,6,9H2 |
| InChIKey | XADXMVMMLOFSDH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|