About 5-imidazo[1,2-a]pyridin-2-yl-8-methoxy-1-methyl-3,4-dihydroquinolin-2-one
5-imidazo[1,2-a]pyridin-2-yl-8-methoxy-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 13260289) has the molecular formula C18H17N3O2
and a molecular weight of 307.35 g/mol. Its IUPAC name is 5-imidazo[1,2-a]pyridin-2-yl-8-methoxy-1-methyl-3,4-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | 5-imidazo[1,2-a]pyridin-2-yl-8-methoxy-1-methyl-3,4-dihydroquinolin-2-one |
| PubChem CID | 13260289 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 5-imidazo[1,2-a]pyridin-2-yl-8-methoxy-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | COc1ccc(-c2cn3ccccc3n2)c2c1N(C)C(=O)CC2 |
| InChI | InChI=1S/C18H17N3O2/c1-20-17(22)9-7-13-12(6-8-15(23-2)18(13)20)14-11-21-10-4-3-5-16(21)19-14/h3-6,8,10-11H,7,9H2,1-2H3 |
| InChIKey | WAKZBATUJISMDM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-imidazo[1,2-a]pyridin-2-yl-8-methoxy-1-methyl-3,4-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-imidazo[1,2-a]pyridin-2-yl-8-methoxy-1-methyl-3,4-dihydroquinolin-2-one?
The IUPAC name of 5-imidazo[1,2-a]pyridin-2-yl-8-methoxy-1-methyl-3,4-dihydroquinolin-2-one (CID 13260289) is 5-imidazo[1,2-a]pyridin-2-yl-8-methoxy-1-methyl-3,4-dihydroquinolin-2-one.
What is the SMILES notation for 5-imidazo[1,2-a]pyridin-2-yl-8-methoxy-1-methyl-3,4-dihydroquinolin-2-one?
The canonical SMILES for 5-imidazo[1,2-a]pyridin-2-yl-8-methoxy-1-methyl-3,4-dihydroquinolin-2-one is COc1ccc(-c2cn3ccccc3n2)c2c1N(C)C(=O)CC2.
What is the InChIKey of 5-imidazo[1,2-a]pyridin-2-yl-8-methoxy-1-methyl-3,4-dihydroquinolin-2-one?
The InChIKey is WAKZBATUJISMDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2/c1-20-17(22)9-7-13-12(6-8-15(23-2)18(13)20)14-11-21-10-4-3-5-16(21)19-14/h3-6,8,10-11H,7,9H2,1-2H3.
What are the key properties of 5-imidazo[1,2-a]pyridin-2-yl-8-methoxy-1-methyl-3,4-dihydroquinolin-2-one?
5-imidazo[1,2-a]pyridin-2-yl-8-methoxy-1-methyl-3,4-dihydroquinolin-2-one has a molecular weight of 307.35 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-imidazo[1,2-a]pyridin-2-yl-8-methoxy-1-methyl-3,4-dihydroquinolin-2-one is sourced from PubChem (CID 13260289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).