C28H28N2O4S — CID 132603413
(2Z)-2-[(3R)-1-[(4-methoxyphenyl)methyl]-1'-(4-methylphenyl)sulfonylspiro[2H-indole-3,3'-pyrrolidine]-2'-ylidene]acetaldehyde (PubChem CID 132603413) has the molecular formula C28H28N2O4S and a molecular weight of 488.61 g/mol. Its IUPAC name is (2Z)-2-[(3R)-1-[(4-methoxyphenyl)methyl]-1'-(4-methylphenyl)sulfonylspiro[2H-indole-3,3'-pyrrolidine]-2'-ylidene]acetaldehyde.
| Compound Name | (2Z)-2-[(3R)-1-[(4-methoxyphenyl)methyl]-1'-(4-methylphenyl)sulfonylspiro[2H-indole-3,3'-pyrrolidine]-2'-ylidene]acetaldehyde |
|---|---|
| PubChem CID | 132603413 |
| Molecular Formula | C28H28N2O4S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | (2Z)-2-[(3R)-1-[(4-methoxyphenyl)methyl]-1'-(4-methylphenyl)sulfonylspiro[2H-indole-3,3'-pyrrolidine]-2'-ylidene]acetaldehyde |
| SMILES | COc1ccc(CN2C[C@@]3(CCN(S(=O)(=O)c4ccc(C)cc4)/C3=C\C=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H28N2O4S/c1-21-7-13-24(14-8-21)35(32,33)30-17-16-28(27(30)15-18-31)20-29(26-6-4-3-5-25(26)28)19-22-9-11-23(34-2)12-10-22/h3-15,18H,16-17,19-20H2,1-2H3/b27-15-/t28-/m0/s1 |
| InChIKey | JEPZNXGVMTYIDA-QICARQTCSA-N |
| XLogP | 4.44 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|