About 7-fluoro-1-methylspiro[indole-3,2'-oxirane]-2-one
7-fluoro-1-methylspiro[indole-3,2'-oxirane]-2-one (PubChem CID 132603447) has the molecular formula C10H8FNO2
and a molecular weight of 193.18 g/mol. Its IUPAC name is 7-fluoro-1-methylspiro[indole-3,2'-oxirane]-2-one.
Molecular Properties
| Compound Name | 7-fluoro-1-methylspiro[indole-3,2'-oxirane]-2-one |
| PubChem CID | 132603447 |
| Molecular Formula | C10H8FNO2 |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 7-fluoro-1-methylspiro[indole-3,2'-oxirane]-2-one |
| SMILES | CN1C(=O)C2(CO2)c2cccc(F)c21 |
| InChI | InChI=1S/C10H8FNO2/c1-12-8-6(3-2-4-7(8)11)10(5-14-10)9(12)13/h2-4H,5H2,1H3 |
| InChIKey | OXKNLYGUEAMTCC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-1-methylspiro[indole-3,2'-oxirane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-1-methylspiro[indole-3,2'-oxirane]-2-one?
The IUPAC name of 7-fluoro-1-methylspiro[indole-3,2'-oxirane]-2-one (CID 132603447) is 7-fluoro-1-methylspiro[indole-3,2'-oxirane]-2-one.
What is the SMILES notation for 7-fluoro-1-methylspiro[indole-3,2'-oxirane]-2-one?
The canonical SMILES for 7-fluoro-1-methylspiro[indole-3,2'-oxirane]-2-one is CN1C(=O)C2(CO2)c2cccc(F)c21.
What is the InChIKey of 7-fluoro-1-methylspiro[indole-3,2'-oxirane]-2-one?
The InChIKey is OXKNLYGUEAMTCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8FNO2/c1-12-8-6(3-2-4-7(8)11)10(5-14-10)9(12)13/h2-4H,5H2,1H3.
What are the key properties of 7-fluoro-1-methylspiro[indole-3,2'-oxirane]-2-one?
7-fluoro-1-methylspiro[indole-3,2'-oxirane]-2-one has a molecular weight of 193.18 g/mol, XLogP of 1.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-1-methylspiro[indole-3,2'-oxirane]-2-one is sourced from PubChem (CID 132603447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).