C12H13ClO — CID 132603580
(1S,2R)-2-(4-chlorophenyl)-1-methylcyclopent-3-en-1-ol (PubChem CID 132603580) has the molecular formula C12H13ClO and a molecular weight of 208.69 g/mol. Its IUPAC name is (1S,2R)-2-(4-chlorophenyl)-1-methylcyclopent-3-en-1-ol.
| Compound Name | (1S,2R)-2-(4-chlorophenyl)-1-methylcyclopent-3-en-1-ol |
|---|---|
| PubChem CID | 132603580 |
| Molecular Formula | C12H13ClO |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (1S,2R)-2-(4-chlorophenyl)-1-methylcyclopent-3-en-1-ol |
| SMILES | C[C@]1(O)CC=C[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClO/c1-12(14)8-2-3-11(12)9-4-6-10(13)7-5-9/h2-7,11,14H,8H2,1H3/t11-,12+/m1/s1 |
| InChIKey | OKMYKGQPPGBLTM-NEPJUHHUSA-N |
| XLogP | 3.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|