C25H30O4 — CID 132603682
4-methoxy-3-[(Z)-2-(2,2,8,8-tetramethyl-3,4,6,7-tetrahydropyrano[3,2-g]chromen-5-yl)ethenyl]phenol (PubChem CID 132603682) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is 4-methoxy-3-[(Z)-2-(2,2,8,8-tetramethyl-3,4,6,7-tetrahydropyrano[3,2-g]chromen-5-yl)ethenyl]phenol.
| Compound Name | 4-methoxy-3-[(Z)-2-(2,2,8,8-tetramethyl-3,4,6,7-tetrahydropyrano[3,2-g]chromen-5-yl)ethenyl]phenol |
|---|---|
| PubChem CID | 132603682 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 4-methoxy-3-[(Z)-2-(2,2,8,8-tetramethyl-3,4,6,7-tetrahydropyrano[3,2-g]chromen-5-yl)ethenyl]phenol |
| SMILES | COc1ccc(O)cc1/C=C\c1c2c(cc3c1CCC(C)(C)O3)OC(C)(C)CC2 |
| InChI | InChI=1S/C25H30O4/c1-24(2)12-10-19-18(8-6-16-14-17(26)7-9-21(16)27-5)20-11-13-25(3,4)29-23(20)15-22(19)28-24/h6-9,14-15,26H,10-13H2,1-5H3/b8-6- |
| InChIKey | PVUBSGWVSROXSU-VURMDHGXSA-N |
| XLogP | 5.78 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|