C14H28O2Si — CID 132603845
2,2,9,9-tetramethyl-1,8-dioxa-7-silaspiro[6.6]tridecane (PubChem CID 132603845) has the molecular formula C14H28O2Si and a molecular weight of 256.46 g/mol. Its IUPAC name is 2,2,9,9-tetramethyl-1,8-dioxa-7-silaspiro[6.6]tridecane.
| Compound Name | 2,2,9,9-tetramethyl-1,8-dioxa-7-silaspiro[6.6]tridecane |
|---|---|
| PubChem CID | 132603845 |
| Molecular Formula | C14H28O2Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 2,2,9,9-tetramethyl-1,8-dioxa-7-silaspiro[6.6]tridecane |
| SMILES | CC1(C)CCCC[Si]2(CCCCC(C)(C)O2)O1 |
| InChI | InChI=1S/C14H28O2Si/c1-13(2)9-5-7-11-17(15-13)12-8-6-10-14(3,4)16-17/h5-12H2,1-4H3 |
| InChIKey | LYIUHKHIMGWTLY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|