C24H40O7 — CID 132603958
[(3aS,5R,9S,10E,11aR)-5-heptyl-2,2-dimethyl-7-oxo-3a,4,5,8,9,11a-hexahydro-[1,3]dioxolo[4,5-d]oxecin-9-yl] (2S,3S)-3-hydroxy-2-methylbutanoate (PubChem CID 132603958) has the molecular formula C24H40O7 and a molecular weight of 440.58 g/mol. Its IUPAC name is [(3aS,5R,9S,10E,11aR)-5-heptyl-2,2-dimethyl-7-oxo-3a,4,5,8,9,11a-hexahydro-[1,3]dioxolo[4,5-d]oxecin-9-yl] (2S,3S)-3-hydroxy-2-methylbutanoate.
| Compound Name | [(3aS,5R,9S,10E,11aR)-5-heptyl-2,2-dimethyl-7-oxo-3a,4,5,8,9,11a-hexahydro-[1,3]dioxolo[4,5-d]oxecin-9-yl] (2S,3S)-3-hydroxy-2-methylbutanoate |
|---|---|
| PubChem CID | 132603958 |
| Molecular Formula | C24H40O7 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | [(3aS,5R,9S,10E,11aR)-5-heptyl-2,2-dimethyl-7-oxo-3a,4,5,8,9,11a-hexahydro-[1,3]dioxolo[4,5-d]oxecin-9-yl] (2S,3S)-3-hydroxy-2-methylbutanoate |
| SMILES | CCCCCCC[C@@H]1C[C@@H]2OC(C)(C)O[C@@H]2/C=C/[C@@H](OC(=O)[C@@H](C)[C@H](C)O)CC(=O)O1 |
| InChI | InChI=1S/C24H40O7/c1-6-7-8-9-10-11-18-14-21-20(30-24(4,5)31-21)13-12-19(15-22(26)28-18)29-23(27)16(2)17(3)25/h12-13,16-21,25H,6-11,14-15H2,1-5H3/b13-12+/t16-,17-,18+,19+,20+,21-/m0/s1 |
| InChIKey | VDAXWYVGYRDQOP-SBWNFRLESA-N |
| XLogP | 4.06 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|