C21H33NO3 — CID 13260475
4,4-dihexyl-6-methoxy-1H-3,1-benzoxazin-2-one (PubChem CID 13260475) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is 4,4-dihexyl-6-methoxy-1H-3,1-benzoxazin-2-one.
| Compound Name | 4,4-dihexyl-6-methoxy-1H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 13260475 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | 4,4-dihexyl-6-methoxy-1H-3,1-benzoxazin-2-one |
| SMILES | CCCCCCC1(CCCCCC)OC(=O)Nc2ccc(OC)cc21 |
| InChI | InChI=1S/C21H33NO3/c1-4-6-8-10-14-21(15-11-9-7-5-2)18-16-17(24-3)12-13-19(18)22-20(23)25-21/h12-13,16H,4-11,14-15H2,1-3H3,(H,22,23) |
| InChIKey | VQGCLJORFKKKHG-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|