C20H26O4 — CID 132604978
(6aS,10aS)-10,11-dihydroxy-7,7,10a-trimethyl-1,2,5,6,6a,8,9,10-octahydronaphtho[1,2-h]isochromen-4-one (PubChem CID 132604978) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (6aS,10aS)-10,11-dihydroxy-7,7,10a-trimethyl-1,2,5,6,6a,8,9,10-octahydronaphtho[1,2-h]isochromen-4-one.
| Compound Name | (6aS,10aS)-10,11-dihydroxy-7,7,10a-trimethyl-1,2,5,6,6a,8,9,10-octahydronaphtho[1,2-h]isochromen-4-one |
|---|---|
| PubChem CID | 132604978 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (6aS,10aS)-10,11-dihydroxy-7,7,10a-trimethyl-1,2,5,6,6a,8,9,10-octahydronaphtho[1,2-h]isochromen-4-one |
| SMILES | CC1(C)CCC(O)[C@]2(C)c3c(O)cc4c(c3CC[C@@H]12)C(=O)OCC4 |
| InChI | InChI=1S/C20H26O4/c1-19(2)8-6-15(22)20(3)14(19)5-4-12-16-11(7-9-24-18(16)23)10-13(21)17(12)20/h10,14-15,21-22H,4-9H2,1-3H3/t14-,15?,20+/m0/s1 |
| InChIKey | ZSKAIOHXGQRCON-UZMOSDRWSA-N |
| XLogP | 3.11 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |