About 1-(4-methoxyphenyl)-2-phenyl-1,4-dihydropyrazino[1,2-a]benzimidazol-3-one
1-(4-methoxyphenyl)-2-phenyl-1,4-dihydropyrazino[1,2-a]benzimidazol-3-one (PubChem CID 132605098) has the molecular formula C23H19N3O2
and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-phenyl-1,4-dihydropyrazino[1,2-a]benzimidazol-3-one.
Molecular Properties
| Compound Name | 1-(4-methoxyphenyl)-2-phenyl-1,4-dihydropyrazino[1,2-a]benzimidazol-3-one |
| PubChem CID | 132605098 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-phenyl-1,4-dihydropyrazino[1,2-a]benzimidazol-3-one |
| SMILES | COc1ccc(C2c3nc4ccccc4n3CC(=O)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19N3O2/c1-28-18-13-11-16(12-14-18)22-23-24-19-9-5-6-10-20(19)25(23)15-21(27)26(22)17-7-3-2-4-8-17/h2-14,22H,15H2,1H3 |
| InChIKey | TZIIFMBOQSMQTO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-methoxyphenyl)-2-phenyl-1,4-dihydropyrazino[1,2-a]benzimidazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxyphenyl)-2-phenyl-1,4-dihydropyrazino[1,2-a]benzimidazol-3-one?
The IUPAC name of 1-(4-methoxyphenyl)-2-phenyl-1,4-dihydropyrazino[1,2-a]benzimidazol-3-one (CID 132605098) is 1-(4-methoxyphenyl)-2-phenyl-1,4-dihydropyrazino[1,2-a]benzimidazol-3-one.
What is the SMILES notation for 1-(4-methoxyphenyl)-2-phenyl-1,4-dihydropyrazino[1,2-a]benzimidazol-3-one?
The canonical SMILES for 1-(4-methoxyphenyl)-2-phenyl-1,4-dihydropyrazino[1,2-a]benzimidazol-3-one is COc1ccc(C2c3nc4ccccc4n3CC(=O)N2c2ccccc2)cc1.
What is the InChIKey of 1-(4-methoxyphenyl)-2-phenyl-1,4-dihydropyrazino[1,2-a]benzimidazol-3-one?
The InChIKey is TZIIFMBOQSMQTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N3O2/c1-28-18-13-11-16(12-14-18)22-23-24-19-9-5-6-10-20(19)25(23)15-21(27)26(22)17-7-3-2-4-8-17/h2-14,22H,15H2,1H3.
What are the key properties of 1-(4-methoxyphenyl)-2-phenyl-1,4-dihydropyrazino[1,2-a]benzimidazol-3-one?
1-(4-methoxyphenyl)-2-phenyl-1,4-dihydropyrazino[1,2-a]benzimidazol-3-one has a molecular weight of 369.42 g/mol, XLogP of 4.18, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxyphenyl)-2-phenyl-1,4-dihydropyrazino[1,2-a]benzimidazol-3-one is sourced from PubChem (CID 132605098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).