C32H24ClN3O3 — CID 132605390
CID 132605390 (PubChem CID 132605390) has the molecular formula C32H24ClN3O3 and a molecular weight of 534.02 g/mol.
| Compound Name | CID 132605390 |
|---|---|
| PubChem CID | 132605390 |
| Molecular Formula | C32H24ClN3O3 |
| Molecular Weight | 534.02 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | — |
| SMILES | O=C(c1ccc(Cl)cc1)[C@H]1[C@H](Cc2ccccc2)N[C@@]2(C(=O)Nc3ccccc32)[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C32H24ClN3O3/c33-21-16-14-20(15-17-21)28(37)27-26(18-19-8-2-1-3-9-19)36-32(23-11-5-7-13-25(23)35-30(32)39)31(27)22-10-4-6-12-24(22)34-29(31)38/h1-17,26-27,36H,18H2,(H,34,38)(H,35,39)/t26-,27+,31+,32-/m0/s1 |
| InChIKey | MJURIBJZHOEEAX-MAMCHFAYSA-N |
| XLogP | 5.09 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.02 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |