C21H25NO4S — CID 13260559
4,4-dimethyl-6-[4-(4-methylphenyl)sulfinylbutoxy]-1H-3,1-benzoxazin-2-one (PubChem CID 13260559) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is 4,4-dimethyl-6-[4-(4-methylphenyl)sulfinylbutoxy]-1H-3,1-benzoxazin-2-one.
| Compound Name | 4,4-dimethyl-6-[4-(4-methylphenyl)sulfinylbutoxy]-1H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 13260559 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 4,4-dimethyl-6-[4-(4-methylphenyl)sulfinylbutoxy]-1H-3,1-benzoxazin-2-one |
| SMILES | Cc1ccc(S(=O)CCCCOc2ccc3c(c2)C(C)(C)OC(=O)N3)cc1 |
| InChI | InChI=1S/C21H25NO4S/c1-15-6-9-17(10-7-15)27(24)13-5-4-12-25-16-8-11-19-18(14-16)21(2,3)26-20(23)22-19/h6-11,14H,4-5,12-13H2,1-3H3,(H,22,23) |
| InChIKey | SWCBMQNZNTUHSN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|