About N-cyclohexyl-2-[(1,3-dioxoisoindol-2-yl)-prop-2-enylamino]-3-methylbutanamide
N-cyclohexyl-2-[(1,3-dioxoisoindol-2-yl)-prop-2-enylamino]-3-methylbutanamide (PubChem CID 132605819) has the molecular formula C22H29N3O3
and a molecular weight of 383.49 g/mol. Its IUPAC name is N-cyclohexyl-2-[(1,3-dioxoisoindol-2-yl)-prop-2-enylamino]-3-methylbutanamide.
Molecular Properties
| Compound Name | N-cyclohexyl-2-[(1,3-dioxoisoindol-2-yl)-prop-2-enylamino]-3-methylbutanamide |
| PubChem CID | 132605819 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | N-cyclohexyl-2-[(1,3-dioxoisoindol-2-yl)-prop-2-enylamino]-3-methylbutanamide |
| SMILES | C=CCN(C(C(=O)NC1CCCCC1)C(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H29N3O3/c1-4-14-24(25-21(27)17-12-8-9-13-18(17)22(25)28)19(15(2)3)20(26)23-16-10-6-5-7-11-16/h4,8-9,12-13,15-16,19H,1,5-7,10-11,14H2,2-3H3,(H,23,26) |
| InChIKey | YOXFYGCLKGFPPN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-2-[(1,3-dioxoisoindol-2-yl)-prop-2-enylamino]-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-2-[(1,3-dioxoisoindol-2-yl)-prop-2-enylamino]-3-methylbutanamide?
The IUPAC name of N-cyclohexyl-2-[(1,3-dioxoisoindol-2-yl)-prop-2-enylamino]-3-methylbutanamide (CID 132605819) is N-cyclohexyl-2-[(1,3-dioxoisoindol-2-yl)-prop-2-enylamino]-3-methylbutanamide.
What is the SMILES notation for N-cyclohexyl-2-[(1,3-dioxoisoindol-2-yl)-prop-2-enylamino]-3-methylbutanamide?
The canonical SMILES for N-cyclohexyl-2-[(1,3-dioxoisoindol-2-yl)-prop-2-enylamino]-3-methylbutanamide is C=CCN(C(C(=O)NC1CCCCC1)C(C)C)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of N-cyclohexyl-2-[(1,3-dioxoisoindol-2-yl)-prop-2-enylamino]-3-methylbutanamide?
The InChIKey is YOXFYGCLKGFPPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N3O3/c1-4-14-24(25-21(27)17-12-8-9-13-18(17)22(25)28)19(15(2)3)20(26)23-16-10-6-5-7-11-16/h4,8-9,12-13,15-16,19H,1,5-7,10-11,14H2,2-3H3,(H,23,26).
What are the key properties of N-cyclohexyl-2-[(1,3-dioxoisoindol-2-yl)-prop-2-enylamino]-3-methylbutanamide?
N-cyclohexyl-2-[(1,3-dioxoisoindol-2-yl)-prop-2-enylamino]-3-methylbutanamide has a molecular weight of 383.49 g/mol, XLogP of 3.16, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-2-[(1,3-dioxoisoindol-2-yl)-prop-2-enylamino]-3-methylbutanamide is sourced from PubChem (CID 132605819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).