About ethyl 7-chloro-6,8-difluoro-5-nitro-4-oxo-1H-quinoline-3-carboxylate
ethyl 7-chloro-6,8-difluoro-5-nitro-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 13260603) has the molecular formula C12H7ClF2N2O5
and a molecular weight of 332.65 g/mol. Its IUPAC name is ethyl 7-chloro-6,8-difluoro-5-nitro-4-oxo-1H-quinoline-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-chloro-6,8-difluoro-5-nitro-4-oxo-1H-quinoline-3-carboxylate |
| PubChem CID | 13260603 |
| Molecular Formula | C12H7ClF2N2O5 |
| Molecular Weight | 332.65 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | ethyl 7-chloro-6,8-difluoro-5-nitro-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2c(F)c(Cl)c(F)c([N+](=O)[O-])c2c1=O |
| InChI | InChI=1S/C12H7ClF2N2O5/c1-2-22-12(19)4-3-16-9-5(11(4)18)10(17(20)21)8(15)6(13)7(9)14/h3H,2H2,1H3,(H,16,18) |
| InChIKey | DOUMTXPBSZHZMH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.65 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-chloro-6,8-difluoro-5-nitro-4-oxo-1H-quinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-chloro-6,8-difluoro-5-nitro-4-oxo-1H-quinoline-3-carboxylate?
The IUPAC name of ethyl 7-chloro-6,8-difluoro-5-nitro-4-oxo-1H-quinoline-3-carboxylate (CID 13260603) is ethyl 7-chloro-6,8-difluoro-5-nitro-4-oxo-1H-quinoline-3-carboxylate.
What is the SMILES notation for ethyl 7-chloro-6,8-difluoro-5-nitro-4-oxo-1H-quinoline-3-carboxylate?
The canonical SMILES for ethyl 7-chloro-6,8-difluoro-5-nitro-4-oxo-1H-quinoline-3-carboxylate is CCOC(=O)c1c[nH]c2c(F)c(Cl)c(F)c([N+](=O)[O-])c2c1=O.
What is the InChIKey of ethyl 7-chloro-6,8-difluoro-5-nitro-4-oxo-1H-quinoline-3-carboxylate?
The InChIKey is DOUMTXPBSZHZMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7ClF2N2O5/c1-2-22-12(19)4-3-16-9-5(11(4)18)10(17(20)21)8(15)6(13)7(9)14/h3H,2H2,1H3,(H,16,18).
What are the key properties of ethyl 7-chloro-6,8-difluoro-5-nitro-4-oxo-1H-quinoline-3-carboxylate?
ethyl 7-chloro-6,8-difluoro-5-nitro-4-oxo-1H-quinoline-3-carboxylate has a molecular weight of 332.65 g/mol, XLogP of 2.54, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-chloro-6,8-difluoro-5-nitro-4-oxo-1H-quinoline-3-carboxylate is sourced from PubChem (CID 13260603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).