C38H44N2O6 — CID 132606055
methyl 4-[2-[2,5-bis[2-(diethylamino)ethoxy]-4-[2-(4-methoxycarbonylphenyl)ethynyl]phenyl]ethynyl]benzoate (PubChem CID 132606055) has the molecular formula C38H44N2O6 and a molecular weight of 624.78 g/mol. Its IUPAC name is methyl 4-[2-[2,5-bis[2-(diethylamino)ethoxy]-4-[2-(4-methoxycarbonylphenyl)ethynyl]phenyl]ethynyl]benzoate.
| Compound Name | methyl 4-[2-[2,5-bis[2-(diethylamino)ethoxy]-4-[2-(4-methoxycarbonylphenyl)ethynyl]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 132606055 |
| Molecular Formula | C38H44N2O6 |
| Molecular Weight | 624.78 g/mol |
| Exact Mass | 624.32 |
| IUPAC Name | methyl 4-[2-[2,5-bis[2-(diethylamino)ethoxy]-4-[2-(4-methoxycarbonylphenyl)ethynyl]phenyl]ethynyl]benzoate |
| SMILES | CCN(CC)CCOc1cc(C#Cc2ccc(C(=O)OC)cc2)c(OCCN(CC)CC)cc1C#Cc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C38H44N2O6/c1-7-39(8-2)23-25-45-35-27-34(22-16-30-13-19-32(20-14-30)38(42)44-6)36(46-26-24-40(9-3)10-4)28-33(35)21-15-29-11-17-31(18-12-29)37(41)43-5/h11-14,17-20,27-28H,7-10,23-26H2,1-6H3 |
| InChIKey | OTTYTOYCRYDCEK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.78 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|