C13H10BrF3O4S — CID 132606114
(5-bromo-1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-3-yl) trifluoromethanesulfonate (PubChem CID 132606114) has the molecular formula C13H10BrF3O4S and a molecular weight of 399.18 g/mol. Its IUPAC name is (5-bromo-1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-3-yl) trifluoromethanesulfonate.
| Compound Name | (5-bromo-1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-3-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 132606114 |
| Molecular Formula | C13H10BrF3O4S |
| Molecular Weight | 399.18 g/mol |
| Exact Mass | 397.94 |
| IUPAC Name | (5-bromo-1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-3-yl) trifluoromethanesulfonate |
| SMILES | CC12C=CC(C)(O1)c1c(OS(=O)(=O)C(F)(F)F)cc(Br)cc12 |
| InChI | InChI=1S/C13H10BrF3O4S/c1-11-3-4-12(2,21-11)10-8(11)5-7(14)6-9(10)20-22(18,19)13(15,16)17/h3-6H,1-2H3 |
| InChIKey | ZWPXAYXYBKCXCQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.18 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|