C29H32O6 — CID 132606866
[(1R,2S,5S,8R,9S,10S,11R,18R)-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-14-en-18-yl] (E)-3-phenylprop-2-enoate (PubChem CID 132606866) has the molecular formula C29H32O6 and a molecular weight of 476.57 g/mol. Its IUPAC name is [(1R,2S,5S,8R,9S,10S,11R,18R)-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-14-en-18-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(1R,2S,5S,8R,9S,10S,11R,18R)-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-14-en-18-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 132606866 |
| Molecular Formula | C29H32O6 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | [(1R,2S,5S,8R,9S,10S,11R,18R)-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-14-en-18-yl] (E)-3-phenylprop-2-enoate |
| SMILES | C=C1C(=O)[C@]23[C@H](OC(=O)/C=C/c4ccccc4)[C@H]1CC[C@H]2[C@]12C=CCC(C)(C)[C@H]1[C@H](O)[C@@]3(O)OC2 |
| InChI | InChI=1S/C29H32O6/c1-17-19-11-12-20-27-15-7-14-26(2,3)22(27)24(32)29(33,34-16-27)28(20,23(17)31)25(19)35-21(30)13-10-18-8-5-4-6-9-18/h4-10,13,15,19-20,22,24-25,32-33H,1,11-12,14,16H2,2-3H3/b13-10+/t19-,20-,22+,24-,25+,27+,28-,29+/m0/s1 |
| InChIKey | CZGDVPSYIOJAFZ-FJHPCSMZSA-N |
| XLogP | 3.45 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|