C21H8F8S2 — CID 132607101
(1R,2R)-1,2,12,12,13,13,14,14-octafluoro-3,23-dithiahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-4,6,8,10,15,17,19,21-octaene (PubChem CID 132607101) has the molecular formula C21H8F8S2 and a molecular weight of 476.41 g/mol. Its IUPAC name is (1R,2R)-1,2,12,12,13,13,14,14-octafluoro-3,23-dithiahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-4,6,8,10,15,17,19,21-octaene.
| Compound Name | (1R,2R)-1,2,12,12,13,13,14,14-octafluoro-3,23-dithiahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-4,6,8,10,15,17,19,21-octaene |
|---|---|
| PubChem CID | 132607101 |
| Molecular Formula | C21H8F8S2 |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | (1R,2R)-1,2,12,12,13,13,14,14-octafluoro-3,23-dithiahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-4,6,8,10,15,17,19,21-octaene |
| SMILES | FC1(F)C2=C3c4ccccc4S[C@@]3(F)[C@]3(F)Sc4ccccc4C3=C2C(F)(F)C1(F)F |
| InChI | InChI=1S/C21H8F8S2/c22-17(23)15-13-9-5-1-3-7-11(9)30-19(13,26)20(27)14(10-6-2-4-8-12(10)31-20)16(15)18(24,25)21(17,28)29/h1-8H/t19-,20-/m1/s1 |
| InChIKey | ZKDZSXOIKAFCAX-WOJBJXKFSA-N |
| XLogP | 7.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|