C19H18O2 — CID 132607318
2-(1,2,3,4-tetrahydrophenanthren-9-yl)-2,3-dihydropyran-6-one (PubChem CID 132607318) has the molecular formula C19H18O2 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydrophenanthren-9-yl)-2,3-dihydropyran-6-one.
| Compound Name | 2-(1,2,3,4-tetrahydrophenanthren-9-yl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 132607318 |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-(1,2,3,4-tetrahydrophenanthren-9-yl)-2,3-dihydropyran-6-one |
| SMILES | O=C1C=CCC(c2cc3c(c4ccccc24)CCCC3)O1 |
| InChI | InChI=1S/C19H18O2/c20-19-11-5-10-18(21-19)17-12-13-6-1-2-7-14(13)15-8-3-4-9-16(15)17/h3-5,8-9,11-12,18H,1-2,6-7,10H2 |
| InChIKey | JQGMMGKDXPSWHB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |