C17H21N — CID 132607323
(4aS,12aS)-12a-methyl-2,3,4a,5,6,12-hexahydro-1H-naphtho[2,1-e]indolizine (PubChem CID 132607323) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is (4aS,12aS)-12a-methyl-2,3,4a,5,6,12-hexahydro-1H-naphtho[2,1-e]indolizine.
| Compound Name | (4aS,12aS)-12a-methyl-2,3,4a,5,6,12-hexahydro-1H-naphtho[2,1-e]indolizine |
|---|---|
| PubChem CID | 132607323 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (4aS,12aS)-12a-methyl-2,3,4a,5,6,12-hexahydro-1H-naphtho[2,1-e]indolizine |
| SMILES | C[C@]12CC=C3c4ccccc4CC[C@@H]3N1CCC2 |
| InChI | InChI=1S/C17H21N/c1-17-10-4-12-18(17)16-8-7-13-5-2-3-6-14(13)15(16)9-11-17/h2-3,5-6,9,16H,4,7-8,10-12H2,1H3/t16-,17-/m0/s1 |
| InChIKey | FQHFJJDTSZRGCU-IRXDYDNUSA-N |
| XLogP | 3.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |