C15H22O4 — CID 132607460
(2R,3R,4E,6E,8E,10E,12R,13R)-pentadeca-4,6,8,10,14-pentaene-2,3,12,13-tetrol (PubChem CID 132607460) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (2R,3R,4E,6E,8E,10E,12R,13R)-pentadeca-4,6,8,10,14-pentaene-2,3,12,13-tetrol.
| Compound Name | (2R,3R,4E,6E,8E,10E,12R,13R)-pentadeca-4,6,8,10,14-pentaene-2,3,12,13-tetrol |
|---|---|
| PubChem CID | 132607460 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (2R,3R,4E,6E,8E,10E,12R,13R)-pentadeca-4,6,8,10,14-pentaene-2,3,12,13-tetrol |
| SMILES | C=C[C@@H](O)[C@H](O)/C=C/C=C/C=C/C=C/[C@@H](O)[C@@H](C)O |
| InChI | InChI=1S/C15H22O4/c1-3-13(17)15(19)11-9-7-5-4-6-8-10-14(18)12(2)16/h3-19H,1H2,2H3/b6-4+,7-5+,10-8+,11-9+/t12-,13-,14-,15-/m1/s1 |
| InChIKey | BAQZAYPZPNPMCQ-LAPRGHAVSA-N |
| XLogP | 0.86 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|