C27H24N6O6 — CID 132607731
2-N,4-N,6-N-tris(1,3-benzodioxol-5-ylmethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 132607731) has the molecular formula C27H24N6O6 and a molecular weight of 528.53 g/mol. Its IUPAC name is 2-N,4-N,6-N-tris(1,3-benzodioxol-5-ylmethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tris(1,3-benzodioxol-5-ylmethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 132607731 |
| Molecular Formula | C27H24N6O6 |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 2-N,4-N,6-N-tris(1,3-benzodioxol-5-ylmethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | c1cc2c(cc1CNc1nc(NCc3ccc4c(c3)OCO4)nc(NCc3ccc4c(c3)OCO4)n1)OCO2 |
| InChI | InChI=1S/C27H24N6O6/c1-4-19-22(37-13-34-19)7-16(1)10-28-25-31-26(29-11-17-2-5-20-23(8-17)38-14-35-20)33-27(32-25)30-12-18-3-6-21-24(9-18)39-15-36-21/h1-9H,10-15H2,(H3,28,29,30,31,32,33) |
| InChIKey | NRSMACVBHNBESR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |