C20H16F3NO2 — CID 132608149
2-phenyl-4-[2-(4,4,4-trifluorobutyl)phenyl]-1,3-oxazin-6-one (PubChem CID 132608149) has the molecular formula C20H16F3NO2 and a molecular weight of 359.35 g/mol. Its IUPAC name is 2-phenyl-4-[2-(4,4,4-trifluorobutyl)phenyl]-1,3-oxazin-6-one.
| Compound Name | 2-phenyl-4-[2-(4,4,4-trifluorobutyl)phenyl]-1,3-oxazin-6-one |
|---|---|
| PubChem CID | 132608149 |
| Molecular Formula | C20H16F3NO2 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 2-phenyl-4-[2-(4,4,4-trifluorobutyl)phenyl]-1,3-oxazin-6-one |
| SMILES | O=c1cc(-c2ccccc2CCCC(F)(F)F)nc(-c2ccccc2)o1 |
| InChI | InChI=1S/C20H16F3NO2/c21-20(22,23)12-6-10-14-7-4-5-11-16(14)17-13-18(25)26-19(24-17)15-8-2-1-3-9-15/h1-5,7-9,11,13H,6,10,12H2 |
| InChIKey | JSVKLCXPWFNPSY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |