C7H6ClN3OS — CID 132608317
3-(2-chloropyrimidin-4-yl)-1,3-thiazolidin-2-one (PubChem CID 132608317) has the molecular formula C7H6ClN3OS and a molecular weight of 215.66 g/mol. Its IUPAC name is 3-(2-chloropyrimidin-4-yl)-1,3-thiazolidin-2-one.
| Compound Name | 3-(2-chloropyrimidin-4-yl)-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 132608317 |
| Molecular Formula | C7H6ClN3OS |
| Molecular Weight | 215.66 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 3-(2-chloropyrimidin-4-yl)-1,3-thiazolidin-2-one |
| SMILES | O=C1SCCN1c1ccnc(Cl)n1 |
| InChI | InChI=1S/C7H6ClN3OS/c8-6-9-2-1-5(10-6)11-3-4-13-7(11)12/h1-2H,3-4H2 |
| InChIKey | WDSIZHSNQCDGGE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.66 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|