C18H19F3N2O — CID 132608843
N-[(1R,2R)-2-(dimethylamino)-1,2-diphenylethyl]-2,2,2-trifluoroacetamide (PubChem CID 132608843) has the molecular formula C18H19F3N2O and a molecular weight of 336.36 g/mol. Its IUPAC name is N-[(1R,2R)-2-(dimethylamino)-1,2-diphenylethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1R,2R)-2-(dimethylamino)-1,2-diphenylethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 132608843 |
| Molecular Formula | C18H19F3N2O |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N-[(1R,2R)-2-(dimethylamino)-1,2-diphenylethyl]-2,2,2-trifluoroacetamide |
| SMILES | CN(C)[C@H](c1ccccc1)[C@H](NC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C18H19F3N2O/c1-23(2)16(14-11-7-4-8-12-14)15(13-9-5-3-6-10-13)22-17(24)18(19,20)21/h3-12,15-16H,1-2H3,(H,22,24)/t15-,16-/m1/s1 |
| InChIKey | QQYKOTRUSUDFAN-HZPDHXFCSA-N |
| XLogP | 3.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |