About 3-diphenylphosphoryl-1,6-dimethylquinolin-2-one
3-diphenylphosphoryl-1,6-dimethylquinolin-2-one (PubChem CID 132608907) has the molecular formula C23H20NO2P
and a molecular weight of 373.39 g/mol. Its IUPAC name is 3-diphenylphosphoryl-1,6-dimethylquinolin-2-one.
Molecular Properties
| Compound Name | 3-diphenylphosphoryl-1,6-dimethylquinolin-2-one |
| PubChem CID | 132608907 |
| Molecular Formula | C23H20NO2P |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 3-diphenylphosphoryl-1,6-dimethylquinolin-2-one |
| SMILES | Cc1ccc2c(c1)cc(P(=O)(c1ccccc1)c1ccccc1)c(=O)n2C |
| InChI | InChI=1S/C23H20NO2P/c1-17-13-14-21-18(15-17)16-22(23(25)24(21)2)27(26,19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-16H,1-2H3 |
| InChIKey | PMNRRFIWWSFRJU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-diphenylphosphoryl-1,6-dimethylquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diphenylphosphoryl-1,6-dimethylquinolin-2-one?
The IUPAC name of 3-diphenylphosphoryl-1,6-dimethylquinolin-2-one (CID 132608907) is 3-diphenylphosphoryl-1,6-dimethylquinolin-2-one.
What is the SMILES notation for 3-diphenylphosphoryl-1,6-dimethylquinolin-2-one?
The canonical SMILES for 3-diphenylphosphoryl-1,6-dimethylquinolin-2-one is Cc1ccc2c(c1)cc(P(=O)(c1ccccc1)c1ccccc1)c(=O)n2C.
What is the InChIKey of 3-diphenylphosphoryl-1,6-dimethylquinolin-2-one?
The InChIKey is PMNRRFIWWSFRJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20NO2P/c1-17-13-14-21-18(15-17)16-22(23(25)24(21)2)27(26,19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-16H,1-2H3.
What are the key properties of 3-diphenylphosphoryl-1,6-dimethylquinolin-2-one?
3-diphenylphosphoryl-1,6-dimethylquinolin-2-one has a molecular weight of 373.39 g/mol, XLogP of 3.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diphenylphosphoryl-1,6-dimethylquinolin-2-one is sourced from PubChem (CID 132608907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).